About (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate
(1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate (PubChem CID 137432473) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate.
Molecular Properties
| Compound Name | (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate |
| PubChem CID | 137432473 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate |
| SMILES | CC(C(=O)OC1(C(C)(C)C)CCCC1)C(C)(C)C |
| InChI | InChI=1S/C16H30O2/c1-12(14(2,3)4)13(17)18-16(15(5,6)7)10-8-9-11-16/h12H,8-11H2,1-7H3 |
| InChIKey | MWLKZUWOTSDWAY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate?
The IUPAC name of (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate (CID 137432473) is (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate.
What is the SMILES notation for (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate?
The canonical SMILES for (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate is CC(C(=O)OC1(C(C)(C)C)CCCC1)C(C)(C)C.
What is the InChIKey of (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate?
The InChIKey is MWLKZUWOTSDWAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-12(14(2,3)4)13(17)18-16(15(5,6)7)10-8-9-11-16/h12H,8-11H2,1-7H3.
What are the key properties of (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate?
(1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate has a molecular weight of 254.41 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butylcyclopentyl) 2,3,3-trimethylbutanoate is sourced from PubChem (CID 137432473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).