About N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide
N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide (PubChem CID 137433089) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide |
| PubChem CID | 137433089 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide |
| SMILES | C=CN/C=N/C/C=N/CC(C)C |
| InChI | InChI=1S/C9H17N3/c1-4-10-8-12-6-5-11-7-9(2)3/h4-5,8-9H,1,6-7H2,2-3H3,(H,10,12)/b11-5+ |
| InChIKey | WZJKGAMBIDRDJN-VZUCSPMQSA-N |
| XLogP | 1.47 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide?
The IUPAC name of N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide (CID 137433089) is N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide.
What is the SMILES notation for N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide?
The canonical SMILES for N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide is C=CN/C=N/C/C=N/CC(C)C.
What is the InChIKey of N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide?
The InChIKey is WZJKGAMBIDRDJN-VZUCSPMQSA-N. The full InChI is InChI=1S/C9H17N3/c1-4-10-8-12-6-5-11-7-9(2)3/h4-5,8-9H,1,6-7H2,2-3H3,(H,10,12)/b11-5+.
What are the key properties of N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide?
N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide has a molecular weight of 167.26 g/mol, XLogP of 1.47, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N'-[2-(2-methylpropylimino)ethyl]methanimidamide is sourced from PubChem (CID 137433089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).