C41H46O8 — CID 137433242
[2,2-bis[(3,5-dimethylbenzoyl)oxymethyl]-3-[(S)-(3,5-dimethylphenyl)-hydroxymethoxy]propyl] 3,5-dimethylbenzoate (PubChem CID 137433242) has the molecular formula C41H46O8 and a molecular weight of 666.81 g/mol. Its IUPAC name is [2,2-bis[(3,5-dimethylbenzoyl)oxymethyl]-3-[(S)-(3,5-dimethylphenyl)-hydroxymethoxy]propyl] 3,5-dimethylbenzoate.
| Compound Name | [2,2-bis[(3,5-dimethylbenzoyl)oxymethyl]-3-[(S)-(3,5-dimethylphenyl)-hydroxymethoxy]propyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 137433242 |
| Molecular Formula | C41H46O8 |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | [2,2-bis[(3,5-dimethylbenzoyl)oxymethyl]-3-[(S)-(3,5-dimethylphenyl)-hydroxymethoxy]propyl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC(COC(=O)c2cc(C)cc(C)c2)(COC(=O)c2cc(C)cc(C)c2)CO[C@H](O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C41H46O8/c1-25-9-26(2)14-33(13-25)37(42)46-21-41(22-47-38(43)34-15-27(3)10-28(4)16-34,23-48-39(44)35-17-29(5)11-30(6)18-35)24-49-40(45)36-19-31(7)12-32(8)20-36/h9-20,37,42H,21-24H2,1-8H3/t37-/m0/s1 |
| InChIKey | WPNAKSHKDPDMGL-QNGWXLTQSA-N |
| XLogP | 7.72 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|