ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate

C9H12BrNO2S — CID 137433439

IUPACethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate
SMILESCCOC(=O)C(C)(C)c1csc(Br)n1
InChIInChI=1S/C9H12BrNO2S/c1-4-13-7(12)9(2,3)6-5-14-8(10)11-6/h5H,4H2,1-3H3
InChIKeySSCZNYYRMKOVBF-UHFFFAOYSA-N
MW278.17 g/mol
LogP2.75
Rot. Bonds3

About ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate

ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate (PubChem CID 137433439) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate.

Molecular Properties

Compound Nameethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate
PubChem CID137433439
Molecular FormulaC9H12BrNO2S
Molecular Weight278.17 g/mol
Exact Mass276.98
IUPAC Nameethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate
SMILESCCOC(=O)C(C)(C)c1csc(Br)n1
InChIInChI=1S/C9H12BrNO2S/c1-4-13-7(12)9(2,3)6-5-14-8(10)11-6/h5H,4H2,1-3H3
InChIKeySSCZNYYRMKOVBF-UHFFFAOYSA-N
XLogP2.75
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.17
LogP ≤ 52.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate?
The IUPAC name of ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate (CID 137433439) is ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate.
What is the SMILES notation for ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate?
The canonical SMILES for ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate is CCOC(=O)C(C)(C)c1csc(Br)n1.
What is the InChIKey of ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate?
The InChIKey is SSCZNYYRMKOVBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO2S/c1-4-13-7(12)9(2,3)6-5-14-8(10)11-6/h5H,4H2,1-3H3.
What are the key properties of ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate?
ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate has a molecular weight of 278.17 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-bromo-1,3-thiazol-4-yl)-2-methylpropanoate is sourced from PubChem (CID 137433439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).