C25H26F2N2O — CID 137433638
(E)-N-[(3E,5Z,6E,7Z)-5,6-bis(prop-2-enylidene)deca-1,3,7,9-tetraen-4-yl]-2-ethenyl-4,4-difluoro-3-(prop-2-enylideneamino)but-2-enamide (PubChem CID 137433638) has the molecular formula C25H26F2N2O and a molecular weight of 408.49 g/mol. Its IUPAC name is (E)-N-[(3E,5Z,6E,7Z)-5,6-bis(prop-2-enylidene)deca-1,3,7,9-tetraen-4-yl]-2-ethenyl-4,4-difluoro-3-(prop-2-enylideneamino)but-2-enamide.
| Compound Name | (E)-N-[(3E,5Z,6E,7Z)-5,6-bis(prop-2-enylidene)deca-1,3,7,9-tetraen-4-yl]-2-ethenyl-4,4-difluoro-3-(prop-2-enylideneamino)but-2-enamide |
|---|---|
| PubChem CID | 137433638 |
| Molecular Formula | C25H26F2N2O |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (E)-N-[(3E,5Z,6E,7Z)-5,6-bis(prop-2-enylidene)deca-1,3,7,9-tetraen-4-yl]-2-ethenyl-4,4-difluoro-3-(prop-2-enylideneamino)but-2-enamide |
| SMILES | C=CC=C(C(/C=C\C=C)=C/C=C)/C(=C\C=C)NC(=O)/C(C=C)=C(/N=C/C=C)C(F)F |
| InChI | InChI=1S/C25H26F2N2O/c1-7-13-17-19(14-8-2)21(15-9-3)22(16-10-4)29-25(30)20(12-6)23(24(26)27)28-18-11-5/h7-18,24H,1-6H2,(H,29,30)/b17-13-,19-14+,21-15-,22-16+,23-20+,28-18+ |
| InChIKey | SHFGXTXCKOIIAX-XLSPTGMMSA-N |
| XLogP | 6.10 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|