C14H16IN5S — CID 137434298
[12-[(3R)-4-ethylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl] thiohypoiodite (PubChem CID 137434298) has the molecular formula C14H16IN5S and a molecular weight of 413.29 g/mol. Its IUPAC name is [12-[(3R)-4-ethylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl] thiohypoiodite.
| Compound Name | [12-[(3R)-4-ethylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl] thiohypoiodite |
|---|---|
| PubChem CID | 137434298 |
| Molecular Formula | C14H16IN5S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | [12-[(3R)-4-ethylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl] thiohypoiodite |
| SMILES | CCC1CNC[C@@H]1c1cnc2cnc3c(ccn3SI)n12 |
| InChI | InChI=1S/C14H16IN5S/c1-2-9-5-16-6-10(9)12-7-17-13-8-18-14-11(20(12)13)3-4-19(14)21-15/h3-4,7-10,16H,2,5-6H2,1H3/t9?,10-/m0/s1 |
| InChIKey | GLHBXDDLCANHGU-AXDSSHIGSA-N |
| XLogP | 3.24 |
| TPSA | 47.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|