C16H19F3N2O4S — CID 137434601
[2-[2-(ethylamino)-2-oxoethyl]spiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-6-yl] trifluoromethanesulfonate (PubChem CID 137434601) has the molecular formula C16H19F3N2O4S and a molecular weight of 392.40 g/mol. Its IUPAC name is [2-[2-(ethylamino)-2-oxoethyl]spiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-6-yl] trifluoromethanesulfonate.
| Compound Name | [2-[2-(ethylamino)-2-oxoethyl]spiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 137434601 |
| Molecular Formula | C16H19F3N2O4S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [2-[2-(ethylamino)-2-oxoethyl]spiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-6-yl] trifluoromethanesulfonate |
| SMILES | CCNC(=O)CN1Cc2ccc(OS(=O)(=O)C(F)(F)F)cc2C2(CC2)C1 |
| InChI | InChI=1S/C16H19F3N2O4S/c1-2-20-14(22)9-21-8-11-3-4-12(25-26(23,24)16(17,18)19)7-13(11)15(10-21)5-6-15/h3-4,7H,2,5-6,8-10H2,1H3,(H,20,22) |
| InChIKey | PNTYLFDDYOJOQD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|