C9H12N2 — CID 137434636
(2Z,4Z)-3-amino-2,6-dimethylhepta-2,4,6-trienenitrile (PubChem CID 137434636) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (2Z,4Z)-3-amino-2,6-dimethylhepta-2,4,6-trienenitrile.
| Compound Name | (2Z,4Z)-3-amino-2,6-dimethylhepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 137434636 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (2Z,4Z)-3-amino-2,6-dimethylhepta-2,4,6-trienenitrile |
| SMILES | C=C(C)/C=C\C(N)=C(/C)C#N |
| InChI | InChI=1S/C9H12N2/c1-7(2)4-5-9(11)8(3)6-10/h4-5H,1,11H2,2-3H3/b5-4-,9-8- |
| InChIKey | OBZCWDSPCLRANH-WPAMCMATSA-N |
| XLogP | 1.87 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|