C35H39N7O6 — CID 137435065
methyl 6-[[3,9-bis[(6-methoxycarbonyl-2-pyridinyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]methyl]pyridine-2-carboxylate (PubChem CID 137435065) has the molecular formula C35H39N7O6 and a molecular weight of 653.74 g/mol. Its IUPAC name is methyl 6-[[3,9-bis[(6-methoxycarbonyl-2-pyridinyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[3,9-bis[(6-methoxycarbonyl-2-pyridinyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 137435065 |
| Molecular Formula | C35H39N7O6 |
| Molecular Weight | 653.74 g/mol |
| Exact Mass | 653.30 |
| IUPAC Name | methyl 6-[[3,9-bis[(6-methoxycarbonyl-2-pyridinyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CN2CCN(Cc3cccc(C(=O)OC)n3)Cc3cccc(n3)CN(Cc3cccc(C(=O)OC)n3)CC2)n1 |
| InChI | InChI=1S/C35H39N7O6/c1-46-33(43)30-13-5-10-27(37-30)20-40-16-18-41(23-28-11-6-14-31(38-28)34(44)47-2)21-25-8-4-9-26(36-25)22-42(19-17-40)24-29-12-7-15-32(39-29)35(45)48-3/h4-15H,16-24H2,1-3H3 |
| InChIKey | SMQMAPYIRMMVKB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 140.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|