C12H21N — CID 137435164
(9Z)-3-ethyl-6-methyl-3,4,5,6,7,8-hexahydroazecine (PubChem CID 137435164) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (9Z)-3-ethyl-6-methyl-3,4,5,6,7,8-hexahydroazecine.
| Compound Name | (9Z)-3-ethyl-6-methyl-3,4,5,6,7,8-hexahydroazecine |
|---|---|
| PubChem CID | 137435164 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (9Z)-3-ethyl-6-methyl-3,4,5,6,7,8-hexahydroazecine |
| SMILES | CCC1/C=N/C=C\CCC(C)CC1 |
| InChI | InChI=1S/C12H21N/c1-3-12-8-7-11(2)6-4-5-9-13-10-12/h5,9-12H,3-4,6-8H2,1-2H3/b9-5-,13-10+ |
| InChIKey | FWQCUZKKGDIBNP-NAQFLYIJSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |