C31H33F4N5O8 — CID 137435258
(2S)-2-amino-4-[[2-[[3-[[2-[4-(4-ethoxy-6-oxo-1H-pyridin-3-yl)-2-fluorophenyl]acetyl]amino]-5-(trifluoromethyl)benzoyl]amino]ethyl-methylamino]methoxy]-4-oxobutanoic acid (PubChem CID 137435258) has the molecular formula C31H33F4N5O8 and a molecular weight of 679.62 g/mol. Its IUPAC name is (2S)-2-amino-4-[[2-[[3-[[2-[4-(4-ethoxy-6-oxo-1H-pyridin-3-yl)-2-fluorophenyl]acetyl]amino]-5-(trifluoromethyl)benzoyl]amino]ethyl-methylamino]methoxy]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[[2-[[3-[[2-[4-(4-ethoxy-6-oxo-1H-pyridin-3-yl)-2-fluorophenyl]acetyl]amino]-5-(trifluoromethyl)benzoyl]amino]ethyl-methylamino]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 137435258 |
| Molecular Formula | C31H33F4N5O8 |
| Molecular Weight | 679.62 g/mol |
| Exact Mass | 679.23 |
| IUPAC Name | (2S)-2-amino-4-[[2-[[3-[[2-[4-(4-ethoxy-6-oxo-1H-pyridin-3-yl)-2-fluorophenyl]acetyl]amino]-5-(trifluoromethyl)benzoyl]amino]ethyl-methylamino]methoxy]-4-oxobutanoic acid |
| SMILES | CCOc1cc(=O)[nH]cc1-c1ccc(CC(=O)Nc2cc(C(=O)NCCN(C)COC(=O)C[C@H](N)C(=O)O)cc(C(F)(F)F)c2)c(F)c1 |
| InChI | InChI=1S/C31H33F4N5O8/c1-3-47-25-14-26(41)38-15-22(25)17-4-5-18(23(32)10-17)11-27(42)39-21-9-19(8-20(12-21)31(33,34)35)29(44)37-6-7-40(2)16-48-28(43)13-24(36)30(45)46/h4-5,8-10,12,14-15,24H,3,6-7,11,13,16,36H2,1-2H3,(H,37,44)(H,38,41)(H,39,42)(H,45,46)/t24-/m0/s1 |
| InChIKey | RGMZUZZJJQJGKE-DEOSSOPVSA-N |
| XLogP | 2.74 |
| TPSA | 193.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|