About 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane
2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane (PubChem CID 137435689) has the molecular formula C23H28F2O4
and a molecular weight of 406.47 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane.
Molecular Properties
| Compound Name | 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane |
| PubChem CID | 137435689 |
| Molecular Formula | C23H28F2O4 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane |
| SMILES | CC(C)(C)OCCOc1c(F)cc(-c2ccc(OC3CCCCO3)cc2)cc1F |
| InChI | InChI=1S/C23H28F2O4/c1-23(2,3)28-13-12-27-22-19(24)14-17(15-20(22)25)16-7-9-18(10-8-16)29-21-6-4-5-11-26-21/h7-10,14-15,21H,4-6,11-13H2,1-3H3 |
| InChIKey | INGREIQKYCRPLR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane?
The IUPAC name of 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane (CID 137435689) is 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane.
What is the SMILES notation for 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane?
The canonical SMILES for 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane is CC(C)(C)OCCOc1c(F)cc(-c2ccc(OC3CCCCO3)cc2)cc1F.
What is the InChIKey of 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane?
The InChIKey is INGREIQKYCRPLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F2O4/c1-23(2,3)28-13-12-27-22-19(24)14-17(15-20(22)25)16-7-9-18(10-8-16)29-21-6-4-5-11-26-21/h7-10,14-15,21H,4-6,11-13H2,1-3H3.
What are the key properties of 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane?
2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane has a molecular weight of 406.47 g/mol, XLogP of 5.73, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]phenoxy]oxane is sourced from PubChem (CID 137435689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).