C25H36N2O — CID 137436163
(3R,5R)-N-(3,3-dimethylpiperidin-4-yl)-3-methyl-5-phenyladamantane-1-carboxamide (PubChem CID 137436163) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is (3R,5R)-N-(3,3-dimethylpiperidin-4-yl)-3-methyl-5-phenyladamantane-1-carboxamide.
| Compound Name | (3R,5R)-N-(3,3-dimethylpiperidin-4-yl)-3-methyl-5-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 137436163 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | (3R,5R)-N-(3,3-dimethylpiperidin-4-yl)-3-methyl-5-phenyladamantane-1-carboxamide |
| SMILES | CC1(C)CNCCC1NC(=O)C12CC3C[C@@](C)(C1)C[C@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C25H36N2O/c1-22(2)17-26-10-9-20(22)27-21(28)25-13-18-11-23(3,15-25)14-24(12-18,16-25)19-7-5-4-6-8-19/h4-8,18,20,26H,9-17H2,1-3H3,(H,27,28)/t18?,20?,23-,24-,25?/m1/s1 |
| InChIKey | ZUTFBAMVBHCZQN-QFHIBMSHSA-N |
| XLogP | 4.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |