C20H26N4S2 — CID 137436477
methyl N'-(2,6-dimethylphenyl)-N-[[N-(2,6-dimethylphenyl)-C-methylsulfanylcarbonimidoyl]amino]carbamimidothioate (PubChem CID 137436477) has the molecular formula C20H26N4S2 and a molecular weight of 386.59 g/mol. Its IUPAC name is methyl N'-(2,6-dimethylphenyl)-N-[[N-(2,6-dimethylphenyl)-C-methylsulfanylcarbonimidoyl]amino]carbamimidothioate.
| Compound Name | methyl N'-(2,6-dimethylphenyl)-N-[[N-(2,6-dimethylphenyl)-C-methylsulfanylcarbonimidoyl]amino]carbamimidothioate |
|---|---|
| PubChem CID | 137436477 |
| Molecular Formula | C20H26N4S2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | methyl N'-(2,6-dimethylphenyl)-N-[[N-(2,6-dimethylphenyl)-C-methylsulfanylcarbonimidoyl]amino]carbamimidothioate |
| SMILES | CS/C(=N\c1c(C)cccc1C)NN/C(=N/c1c(C)cccc1C)SC |
| InChI | InChI=1S/C20H26N4S2/c1-13-9-7-10-14(2)17(13)21-19(25-5)23-24-20(26-6)22-18-15(3)11-8-12-16(18)4/h7-12H,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | GNDUHYNVWLVSKE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|