C13H18N2 — CID 137436644
(3Z,5E)-6-methyl-2-methylidene-5-[(Z)-prop-1-enyl]octa-3,5,7-trienimidamide (PubChem CID 137436644) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (3Z,5E)-6-methyl-2-methylidene-5-[(Z)-prop-1-enyl]octa-3,5,7-trienimidamide.
| Compound Name | (3Z,5E)-6-methyl-2-methylidene-5-[(Z)-prop-1-enyl]octa-3,5,7-trienimidamide |
|---|---|
| PubChem CID | 137436644 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (3Z,5E)-6-methyl-2-methylidene-5-[(Z)-prop-1-enyl]octa-3,5,7-trienimidamide |
| SMILES | [H]/N=C(\N)C(=C)/C=C\C(\C=C/C)=C(/C)C=C |
| InChI | InChI=1S/C13H18N2/c1-5-7-12(10(3)6-2)9-8-11(4)13(14)15/h5-9H,2,4H2,1,3H3,(H3,14,15)/b7-5-,9-8-,12-10+ |
| InChIKey | YBCOTCVVSQYUPH-OBCIJEAPSA-N |
| XLogP | 3.11 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|