About 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide
3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide (PubChem CID 137437060) has the molecular formula C7H7N3O3S
and a molecular weight of 213.22 g/mol. Its IUPAC name is 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide |
| PubChem CID | 137437060 |
| Molecular Formula | C7H7N3O3S |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide |
| SMILES | NS(=O)(=O)c1[nH]c(=O)n2ccccc12 |
| InChI | InChI=1S/C7H7N3O3S/c8-14(12,13)6-5-3-1-2-4-10(5)7(11)9-6/h1-4H,(H,9,11)(H2,8,12,13) |
| InChIKey | BZYLIAFGBNJCOH-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide?
The IUPAC name of 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide (CID 137437060) is 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide.
What is the SMILES notation for 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide?
The canonical SMILES for 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide is NS(=O)(=O)c1[nH]c(=O)n2ccccc12.
What is the InChIKey of 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide?
The InChIKey is BZYLIAFGBNJCOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3S/c8-14(12,13)6-5-3-1-2-4-10(5)7(11)9-6/h1-4H,(H,9,11)(H2,8,12,13).
What are the key properties of 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide?
3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide has a molecular weight of 213.22 g/mol, XLogP of -0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-2H-imidazo[1,5-a]pyridine-1-sulfonamide is sourced from PubChem (CID 137437060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).