About 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol
3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol (PubChem CID 137437309) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol.
Molecular Properties
| Compound Name | 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol |
| PubChem CID | 137437309 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol |
| SMILES | Oc1nc(NCC2CC2)n2ccccc12 |
| InChI | InChI=1S/C11H13N3O/c15-10-9-3-1-2-6-14(9)11(13-10)12-7-8-4-5-8/h1-3,6,8,15H,4-5,7H2,(H,12,13) |
| InChIKey | QIDRZMIXERCLMV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol?
The IUPAC name of 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol (CID 137437309) is 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol.
What is the SMILES notation for 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol?
The canonical SMILES for 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol is Oc1nc(NCC2CC2)n2ccccc12.
What is the InChIKey of 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol?
The InChIKey is QIDRZMIXERCLMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c15-10-9-3-1-2-6-14(9)11(13-10)12-7-8-4-5-8/h1-3,6,8,15H,4-5,7H2,(H,12,13).
What are the key properties of 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol?
3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol has a molecular weight of 203.25 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethylamino)imidazo[1,5-a]pyridin-1-ol is sourced from PubChem (CID 137437309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).