C61H40N4 — CID 137437790
4,10,10-triphenyl-2-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]indeno[1,2-g]quinoline (PubChem CID 137437790) has the molecular formula C61H40N4 and a molecular weight of 829.02 g/mol. Its IUPAC name is 4,10,10-triphenyl-2-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]indeno[1,2-g]quinoline.
| Compound Name | 4,10,10-triphenyl-2-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]indeno[1,2-g]quinoline |
|---|---|
| PubChem CID | 137437790 |
| Molecular Formula | C61H40N4 |
| Molecular Weight | 829.02 g/mol |
| Exact Mass | 828.33 |
| IUPAC Name | 4,10,10-triphenyl-2-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]indeno[1,2-g]quinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5cc(-c6ccccc6)c6cc7c(cc6n5)C(c5ccccc5)(c5ccccc5)c5ccccc5-7)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C61H40N4/c1-6-19-41(20-7-1)42-33-35-45(36-34-42)59-63-58(44-23-10-3-11-24-44)64-60(65-59)47-26-18-25-46(37-47)56-39-51(43-21-8-2-9-22-43)53-38-52-50-31-16-17-32-54(50)61(48-27-12-4-13-28-48,49-29-14-5-15-30-49)55(52)40-57(53)62-56/h1-40H |
| InChIKey | KPRUDOCZKDIUMC-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.02 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |