C9H17N3 — CID 137437974
2-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1H-imidazo[4,5-b]pyridine (PubChem CID 137437974) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 2-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 137437974 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1H-imidazo[4,5-b]pyridine |
| SMILES | CC(C)C1=NC2NCCCC2N1 |
| InChI | InChI=1S/C9H17N3/c1-6(2)8-11-7-4-3-5-10-9(7)12-8/h6-7,9-10H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | AOQCIWLBWGTWEH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |