About 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one
6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one (PubChem CID 137438136) has the molecular formula C20H12ClN3OS2
and a molecular weight of 409.92 g/mol. Its IUPAC name is 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one |
| PubChem CID | 137438136 |
| Molecular Formula | C20H12ClN3OS2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1ccc(-c2nc3[nH]ccc(=O)c3cc2-c2cc(Cl)c3ncsc3c2)s1 |
| InChI | InChI=1S/C20H12ClN3OS2/c1-10-2-3-16(27-10)18-12(8-13-15(25)4-5-22-20(13)24-18)11-6-14(21)19-17(7-11)26-9-23-19/h2-9H,1H3,(H,22,24,25) |
| InChIKey | UAYYPFFBCPIPGV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one?
The IUPAC name of 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one (CID 137438136) is 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one is Cc1ccc(-c2nc3[nH]ccc(=O)c3cc2-c2cc(Cl)c3ncsc3c2)s1.
What is the InChIKey of 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one?
The InChIKey is UAYYPFFBCPIPGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12ClN3OS2/c1-10-2-3-16(27-10)18-12(8-13-15(25)4-5-22-20(13)24-18)11-6-14(21)19-17(7-11)26-9-23-19/h2-9H,1H3,(H,22,24,25).
What are the key properties of 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one?
6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one has a molecular weight of 409.92 g/mol, XLogP of 5.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chloro-1,3-benzothiazol-6-yl)-7-(5-methylthiophen-2-yl)-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 137438136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).