About 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one
6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one (PubChem CID 137438171) has the molecular formula C22H14ClN3OS
and a molecular weight of 403.89 g/mol. Its IUPAC name is 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one |
| PubChem CID | 137438171 |
| Molecular Formula | C22H14ClN3OS |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one |
| SMILES | Cc1nc2c(Cl)cc(-c3cc4ccc(=O)[nH]c4nc3-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C22H14ClN3OS/c1-12-24-21-17(23)10-15(11-18(21)28-12)16-9-14-7-8-19(27)25-22(14)26-20(16)13-5-3-2-4-6-13/h2-11H,1H3,(H,25,26,27) |
| InChIKey | GSVVNXIOYGDLAG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one?
The IUPAC name of 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one (CID 137438171) is 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one is Cc1nc2c(Cl)cc(-c3cc4ccc(=O)[nH]c4nc3-c3ccccc3)cc2s1.
What is the InChIKey of 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one?
The InChIKey is GSVVNXIOYGDLAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14ClN3OS/c1-12-24-21-17(23)10-15(11-18(21)28-12)16-9-14-7-8-19(27)25-22(14)26-20(16)13-5-3-2-4-6-13/h2-11H,1H3,(H,25,26,27).
What are the key properties of 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one?
6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one has a molecular weight of 403.89 g/mol, XLogP of 5.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chloro-2-methyl-1,3-benzothiazol-6-yl)-7-phenyl-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 137438171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).