C20H13ClN4O2 — CID 137438435
6-(2-chloro-6-methyl-4-pyridinyl)-7-(5-methylfuran-2-yl)-4-oxo-1H-1,8-naphthyridine-2-carbonitrile (PubChem CID 137438435) has the molecular formula C20H13ClN4O2 and a molecular weight of 376.80 g/mol. Its IUPAC name is 6-(2-chloro-6-methyl-4-pyridinyl)-7-(5-methylfuran-2-yl)-4-oxo-1H-1,8-naphthyridine-2-carbonitrile.
| Compound Name | 6-(2-chloro-6-methyl-4-pyridinyl)-7-(5-methylfuran-2-yl)-4-oxo-1H-1,8-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 137438435 |
| Molecular Formula | C20H13ClN4O2 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 6-(2-chloro-6-methyl-4-pyridinyl)-7-(5-methylfuran-2-yl)-4-oxo-1H-1,8-naphthyridine-2-carbonitrile |
| SMILES | Cc1cc(-c2cc3c(=O)cc(C#N)[nH]c3nc2-c2ccc(C)o2)cc(Cl)n1 |
| InChI | InChI=1S/C20H13ClN4O2/c1-10-5-12(6-18(21)23-10)14-8-15-16(26)7-13(9-22)24-20(15)25-19(14)17-4-3-11(2)27-17/h3-8H,1-2H3,(H,24,25,26) |
| InChIKey | SLZLYOAESZECHC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|