About 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one
6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one (PubChem CID 137439032) has the molecular formula C24H15ClN4O
and a molecular weight of 410.86 g/mol. Its IUPAC name is 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one |
| PubChem CID | 137439032 |
| Molecular Formula | C24H15ClN4O |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one |
| SMILES | CC#Cc1cc2cc(-c3cc(Cl)c4[nH]ncc4c3)c(-c3ccccc3)nc2[nH]c1=O |
| InChI | InChI=1S/C24H15ClN4O/c1-2-6-15-9-17-11-19(16-10-18-13-26-29-22(18)20(25)12-16)21(14-7-4-3-5-8-14)27-23(17)28-24(15)30/h3-5,7-13H,1H3,(H,26,29)(H,27,28,30) |
| InChIKey | XWLVYHVQAHTQNS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one?
The IUPAC name of 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one (CID 137439032) is 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one is CC#Cc1cc2cc(-c3cc(Cl)c4[nH]ncc4c3)c(-c3ccccc3)nc2[nH]c1=O.
What is the InChIKey of 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one?
The InChIKey is XWLVYHVQAHTQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15ClN4O/c1-2-6-15-9-17-11-19(16-10-18-13-26-29-22(18)20(25)12-16)21(14-7-4-3-5-8-14)27-23(17)28-24(15)30/h3-5,7-13H,1H3,(H,26,29)(H,27,28,30).
What are the key properties of 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one?
6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one has a molecular weight of 410.86 g/mol, XLogP of 5.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(7-chloro-1H-indazol-5-yl)-7-phenyl-3-prop-1-ynyl-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 137439032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).