About 2-fluoro-1,4,6-trimethylpiperidine
2-fluoro-1,4,6-trimethylpiperidine (PubChem CID 137439306) has the molecular formula C8H16FN
and a molecular weight of 145.22 g/mol. Its IUPAC name is 2-fluoro-1,4,6-trimethylpiperidine.
Molecular Properties
| Compound Name | 2-fluoro-1,4,6-trimethylpiperidine |
| PubChem CID | 137439306 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | 2-fluoro-1,4,6-trimethylpiperidine |
| SMILES | CC1CC(C)N(C)C(F)C1 |
| InChI | InChI=1S/C8H16FN/c1-6-4-7(2)10(3)8(9)5-6/h6-8H,4-5H2,1-3H3 |
| InChIKey | FRGPYQOZEVKBFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1,4,6-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,4,6-trimethylpiperidine?
The IUPAC name of 2-fluoro-1,4,6-trimethylpiperidine (CID 137439306) is 2-fluoro-1,4,6-trimethylpiperidine.
What is the SMILES notation for 2-fluoro-1,4,6-trimethylpiperidine?
The canonical SMILES for 2-fluoro-1,4,6-trimethylpiperidine is CC1CC(C)N(C)C(F)C1.
What is the InChIKey of 2-fluoro-1,4,6-trimethylpiperidine?
The InChIKey is FRGPYQOZEVKBFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FN/c1-6-4-7(2)10(3)8(9)5-6/h6-8H,4-5H2,1-3H3.
What are the key properties of 2-fluoro-1,4,6-trimethylpiperidine?
2-fluoro-1,4,6-trimethylpiperidine has a molecular weight of 145.22 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,4,6-trimethylpiperidine is sourced from PubChem (CID 137439306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).