About N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine
N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine (PubChem CID 137439340) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine |
| PubChem CID | 137439340 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine |
| SMILES | CNC[C@H]1C=CC(C(C)C)=CC1 |
| InChI | InChI=1S/C11H19N/c1-9(2)11-6-4-10(5-7-11)8-12-3/h4,6-7,9-10,12H,5,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | SPRMSOKDJSJSGE-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine?
The IUPAC name of N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine (CID 137439340) is N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine.
What is the SMILES notation for N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine?
The canonical SMILES for N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine is CNC[C@H]1C=CC(C(C)C)=CC1.
What is the InChIKey of N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine?
The InChIKey is SPRMSOKDJSJSGE-JTQLQIEISA-N. The full InChI is InChI=1S/C11H19N/c1-9(2)11-6-4-10(5-7-11)8-12-3/h4,6-7,9-10,12H,5,8H2,1-3H3/t10-/m0/s1.
What are the key properties of N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine?
N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine has a molecular weight of 165.28 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]methanamine is sourced from PubChem (CID 137439340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).