C12H19N3 — CID 137439433
1-ethyl-3,4,4a,8a-tetrahydro-2H-quinoline-6-carboximidamide (PubChem CID 137439433) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 1-ethyl-3,4,4a,8a-tetrahydro-2H-quinoline-6-carboximidamide.
| Compound Name | 1-ethyl-3,4,4a,8a-tetrahydro-2H-quinoline-6-carboximidamide |
|---|---|
| PubChem CID | 137439433 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-ethyl-3,4,4a,8a-tetrahydro-2H-quinoline-6-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CC2CCCN(CC)C2C=C1 |
| InChI | InChI=1S/C12H19N3/c1-2-15-7-3-4-9-8-10(12(13)14)5-6-11(9)15/h5-6,8-9,11H,2-4,7H2,1H3,(H3,13,14) |
| InChIKey | RLIOMOASFNUMJM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|