C25H29N5O3 — CID 137439534
4-[[4-[3-(3-amino-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methyl]-1-phenylpyrrolidin-2-one (PubChem CID 137439534) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-[[4-[3-(3-amino-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methyl]-1-phenylpyrrolidin-2-one.
| Compound Name | 4-[[4-[3-(3-amino-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methyl]-1-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 137439534 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 4-[[4-[3-(3-amino-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methyl]-1-phenylpyrrolidin-2-one |
| SMILES | COc1ccc(-c2noc(C3CCN(CC4CC(=O)N(c5ccccc5)C4)CC3)n2)cc1N |
| InChI | InChI=1S/C25H29N5O3/c1-32-22-8-7-19(14-21(22)26)24-27-25(33-28-24)18-9-11-29(12-10-18)15-17-13-23(31)30(16-17)20-5-3-2-4-6-20/h2-8,14,17-18H,9-13,15-16,26H2,1H3 |
| InChIKey | QSXQLAREXFXWCW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|