C17H19F2N5O3 — CID 137439726
methyl 4-[3-[3-(difluoromethylamino)-4-methanimidoylphenyl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate (PubChem CID 137439726) has the molecular formula C17H19F2N5O3 and a molecular weight of 379.37 g/mol. Its IUPAC name is methyl 4-[3-[3-(difluoromethylamino)-4-methanimidoylphenyl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[3-[3-(difluoromethylamino)-4-methanimidoylphenyl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137439726 |
| Molecular Formula | C17H19F2N5O3 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | methyl 4-[3-[3-(difluoromethylamino)-4-methanimidoylphenyl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate |
| SMILES | [H]/N=C/c1ccc(-c2noc(C3CCN(C(=O)OC)CC3)n2)cc1NC(F)F |
| InChI | InChI=1S/C17H19F2N5O3/c1-26-17(25)24-6-4-10(5-7-24)15-22-14(23-27-15)11-2-3-12(9-20)13(8-11)21-16(18)19/h2-3,8-10,16,20-21H,4-7H2,1H3/b20-9+ |
| InChIKey | GZNISJSDEQRWNW-AWQFTUOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|