C10H10F3N3O5 — CID 137440123
[2-(2-aminoethylamino)-1-(2,5-dioxopyrrol-1-yl)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 137440123) has the molecular formula C10H10F3N3O5 and a molecular weight of 309.20 g/mol. Its IUPAC name is [2-(2-aminoethylamino)-1-(2,5-dioxopyrrol-1-yl)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(2-aminoethylamino)-1-(2,5-dioxopyrrol-1-yl)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 137440123 |
| Molecular Formula | C10H10F3N3O5 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | [2-(2-aminoethylamino)-1-(2,5-dioxopyrrol-1-yl)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | NCCNC(=O)C(OC(=O)C(F)(F)F)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H10F3N3O5/c11-10(12,13)9(20)21-8(7(19)15-4-3-14)16-5(17)1-2-6(16)18/h1-2,8H,3-4,14H2,(H,15,19) |
| InChIKey | NUFLPJDHNDNMIS-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|