C14H18F3N3O7 — CID 137440130
[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-1-(2,5-dioxopyrrol-1-yl)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 137440130) has the molecular formula C14H18F3N3O7 and a molecular weight of 397.31 g/mol. Its IUPAC name is [2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-1-(2,5-dioxopyrrol-1-yl)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-1-(2,5-dioxopyrrol-1-yl)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 137440130 |
| Molecular Formula | C14H18F3N3O7 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-1-(2,5-dioxopyrrol-1-yl)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | NCCOCCOCCNC(=O)C(OC(=O)C(F)(F)F)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H18F3N3O7/c15-14(16,17)13(24)27-12(20-9(21)1-2-10(20)22)11(23)19-4-6-26-8-7-25-5-3-18/h1-2,12H,3-8,18H2,(H,19,23) |
| InChIKey | ISJVEUOZDQIUAS-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|