C20H10O4 — CID 137441109
1,6-dihydroperylene-2,3,9,10-tetrone (PubChem CID 137441109) has the molecular formula C20H10O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 1,6-dihydroperylene-2,3,9,10-tetrone.
| Compound Name | 1,6-dihydroperylene-2,3,9,10-tetrone |
|---|---|
| PubChem CID | 137441109 |
| Molecular Formula | C20H10O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1,6-dihydroperylene-2,3,9,10-tetrone |
| SMILES | O=C1Cc2c3c(c4ccc(=O)c5c(=O)ccc2c4=5)CC=CC=3C1=O |
| InChI | InChI=1S/C20H10O4/c21-14-6-4-10-9-2-1-3-12-17(9)13(8-16(23)20(12)24)11-5-7-15(22)19(14)18(10)11/h1,3-7H,2,8H2 |
| InChIKey | NLOJTZJJAFOJBJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|