C21H31N4O4P — CID 137441749
(3S)-3-(4-aminobutyl)-1-[[2-(2,3-dimethylimidazol-4-yl)phenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid (PubChem CID 137441749) has the molecular formula C21H31N4O4P and a molecular weight of 434.48 g/mol. Its IUPAC name is (3S)-3-(4-aminobutyl)-1-[[2-(2,3-dimethylimidazol-4-yl)phenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid.
| Compound Name | (3S)-3-(4-aminobutyl)-1-[[2-(2,3-dimethylimidazol-4-yl)phenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid |
|---|---|
| PubChem CID | 137441749 |
| Molecular Formula | C21H31N4O4P |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (3S)-3-(4-aminobutyl)-1-[[2-(2,3-dimethylimidazol-4-yl)phenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid |
| SMILES | Cc1ncc(-c2ccccc2CN2CCP(=O)(O)[C@](CCCCN)(C(=O)O)C2)n1C |
| InChI | InChI=1S/C21H31N4O4P/c1-16-23-13-19(24(16)2)18-8-4-3-7-17(18)14-25-11-12-30(28,29)21(15-25,20(26)27)9-5-6-10-22/h3-4,7-8,13H,5-6,9-12,14-15,22H2,1-2H3,(H,26,27)(H,28,29)/t21-/m0/s1 |
| InChIKey | ZTGWEXGSAKEIOF-NRFANRHFSA-N |
| XLogP | 2.43 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|