C20H27N4O4P — CID 137441893
3-(4-aminobutyl)-4-hydroxy-4-oxo-1-[(2-pyrimidin-5-ylphenyl)methyl]-1,4λ5-azaphosphinane-3-carboxylic acid (PubChem CID 137441893) has the molecular formula C20H27N4O4P and a molecular weight of 418.43 g/mol. Its IUPAC name is 3-(4-aminobutyl)-4-hydroxy-4-oxo-1-[(2-pyrimidin-5-ylphenyl)methyl]-1,4λ5-azaphosphinane-3-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-4-hydroxy-4-oxo-1-[(2-pyrimidin-5-ylphenyl)methyl]-1,4λ5-azaphosphinane-3-carboxylic acid |
|---|---|
| PubChem CID | 137441893 |
| Molecular Formula | C20H27N4O4P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-(4-aminobutyl)-4-hydroxy-4-oxo-1-[(2-pyrimidin-5-ylphenyl)methyl]-1,4λ5-azaphosphinane-3-carboxylic acid |
| SMILES | NCCCCC1(C(=O)O)CN(Cc2ccccc2-c2cncnc2)CCP1(=O)O |
| InChI | InChI=1S/C20H27N4O4P/c21-8-4-3-7-20(19(25)26)14-24(9-10-29(20,27)28)13-16-5-1-2-6-18(16)17-11-22-15-23-12-17/h1-2,5-6,11-12,15H,3-4,7-10,13-14,21H2,(H,25,26)(H,27,28) |
| InChIKey | PNESMYMKIXRGDJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|