About 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile
2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile (PubChem CID 137442128) has the molecular formula C16H11Cl2N5S
and a molecular weight of 376.27 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile |
| PubChem CID | 137442128 |
| Molecular Formula | C16H11Cl2N5S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile |
| SMILES | CSc1nccc(-n2c(CC#N)cnc2-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H11Cl2N5S/c1-24-16-20-7-5-14(22-16)23-11(4-6-19)9-21-15(23)10-2-3-12(17)13(18)8-10/h2-3,5,7-9H,4H2,1H3 |
| InChIKey | CXOSWUQQVXDGGR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile?
The IUPAC name of 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile (CID 137442128) is 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile.
What is the SMILES notation for 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile?
The canonical SMILES for 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile is CSc1nccc(-n2c(CC#N)cnc2-c2ccc(Cl)c(Cl)c2)n1.
What is the InChIKey of 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile?
The InChIKey is CXOSWUQQVXDGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N5S/c1-24-16-20-7-5-14(22-16)23-11(4-6-19)9-21-15(23)10-2-3-12(17)13(18)8-10/h2-3,5,7-9H,4H2,1H3.
What are the key properties of 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile?
2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile has a molecular weight of 376.27 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dichlorophenyl)-3-(2-methylsulfanylpyrimidin-4-yl)imidazol-4-yl]acetonitrile is sourced from PubChem (CID 137442128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).