C5H6F3NO2S2 — CID 137442374
3-(2,2,2-trifluoroethylsulfonyl)-2H-1,3-thiazole (PubChem CID 137442374) has the molecular formula C5H6F3NO2S2 and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylsulfonyl)-2H-1,3-thiazole.
| Compound Name | 3-(2,2,2-trifluoroethylsulfonyl)-2H-1,3-thiazole |
|---|---|
| PubChem CID | 137442374 |
| Molecular Formula | C5H6F3NO2S2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | 3-(2,2,2-trifluoroethylsulfonyl)-2H-1,3-thiazole |
| SMILES | O=S(=O)(CC(F)(F)F)N1C=CSC1 |
| InChI | InChI=1S/C5H6F3NO2S2/c6-5(7,8)3-13(10,11)9-1-2-12-4-9/h1-2H,3-4H2 |
| InChIKey | PTQGMFHCCOEPKY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |