About lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate
lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate (PubChem CID 137443207) has the molecular formula C6H8LiNO3S2
and a molecular weight of 213.21 g/mol. Its IUPAC name is lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate.
Molecular Properties
| Compound Name | lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate |
| PubChem CID | 137443207 |
| Molecular Formula | C6H8LiNO3S2 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate |
| SMILES | CC(C)(O)c1ncc(S(=O)[O-])s1.[Li+] |
| InChI | InChI=1S/C6H9NO3S2.Li/c1-6(2,8)5-7-3-4(11-5)12(9)10;/h3,8H,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | SVBOXTXKZMONPP-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate?
The IUPAC name of lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate (CID 137443207) is lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate.
What is the SMILES notation for lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate?
The canonical SMILES for lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate is CC(C)(O)c1ncc(S(=O)[O-])s1.[Li+].
What is the InChIKey of lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate?
The InChIKey is SVBOXTXKZMONPP-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H9NO3S2.Li/c1-6(2,8)5-7-3-4(11-5)12(9)10;/h3,8H,1-2H3,(H,9,10);/q;+1/p-1.
What are the key properties of lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate?
lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate has a molecular weight of 213.21 g/mol, XLogP of -2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-(2-hydroxypropan-2-yl)-1,3-thiazole-5-sulfinate is sourced from PubChem (CID 137443207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).