About 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide
2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide (PubChem CID 137443476) has the molecular formula C9H14N2O3S2
and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 137443476 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide |
| SMILES | CC(=O)c1ncc(S(=O)(=O)NC(C)(C)C)s1 |
| InChI | InChI=1S/C9H14N2O3S2/c1-6(12)8-10-5-7(15-8)16(13,14)11-9(2,3)4/h5,11H,1-4H3 |
| InChIKey | DJJLGUAAVVRIBX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide (CID 137443476) is 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide is CC(=O)c1ncc(S(=O)(=O)NC(C)(C)C)s1.
What is the InChIKey of 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide?
The InChIKey is DJJLGUAAVVRIBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S2/c1-6(12)8-10-5-7(15-8)16(13,14)11-9(2,3)4/h5,11H,1-4H3.
What are the key properties of 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide?
2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide has a molecular weight of 262.36 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-N-tert-butyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 137443476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).