About 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide
2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide (PubChem CID 137443490) has the molecular formula C7H12N2O2S2
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide.
Molecular Properties
| Compound Name | 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide |
| PubChem CID | 137443490 |
| Molecular Formula | C7H12N2O2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide |
| SMILES | COC(C)(C)c1ncc(S(N)=O)s1 |
| InChI | InChI=1S/C7H12N2O2S2/c1-7(2,11-3)6-9-4-5(12-6)13(8)10/h4H,8H2,1-3H3 |
| InChIKey | ZSVYOOOZJIONCF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide?
The IUPAC name of 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide (CID 137443490) is 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide.
What is the SMILES notation for 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide?
The canonical SMILES for 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide is COC(C)(C)c1ncc(S(N)=O)s1.
What is the InChIKey of 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide?
The InChIKey is ZSVYOOOZJIONCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S2/c1-7(2,11-3)6-9-4-5(12-6)13(8)10/h4H,8H2,1-3H3.
What are the key properties of 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide?
2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide has a molecular weight of 220.32 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide is sourced from PubChem (CID 137443490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).