C25H27N5O5 — CID 137443571
tert-butyl 1-[(4-methylphenyl)carbamoyl]-3-(3-nitrophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylate (PubChem CID 137443571) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is tert-butyl 1-[(4-methylphenyl)carbamoyl]-3-(3-nitrophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 1-[(4-methylphenyl)carbamoyl]-3-(3-nitrophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 137443571 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | tert-butyl 1-[(4-methylphenyl)carbamoyl]-3-(3-nitrophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylate |
| SMILES | Cc1ccc(NC(=O)c2nc(-c3cccc([N+](=O)[O-])c3)n3c2CN(C(=O)OC(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C25H27N5O5/c1-16-8-10-18(11-9-16)26-23(31)21-20-15-28(24(32)35-25(2,3)4)12-13-29(20)22(27-21)17-6-5-7-19(14-17)30(33)34/h5-11,14H,12-13,15H2,1-4H3,(H,26,31) |
| InChIKey | NMZUJCBUZZQWMG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|