About 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one
1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one (PubChem CID 137443825) has the molecular formula C17H14F4N2O3S
and a molecular weight of 402.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one |
| PubChem CID | 137443825 |
| Molecular Formula | C17H14F4N2O3S |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one |
| SMILES | O=C1N(c2ccc(C(F)(F)F)cc2)CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F4N2O3S/c18-13-4-8-15(9-5-13)27(25,26)23-11-1-10-22(16(23)24)14-6-2-12(3-7-14)17(19,20)21/h2-9H,1,10-11H2 |
| InChIKey | GWYLJLKVVXHGKX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one?
The IUPAC name of 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one (CID 137443825) is 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one.
What is the SMILES notation for 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one?
The canonical SMILES for 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one is O=C1N(c2ccc(C(F)(F)F)cc2)CCCN1S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one?
The InChIKey is GWYLJLKVVXHGKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F4N2O3S/c18-13-4-8-15(9-5-13)27(25,26)23-11-1-10-22(16(23)24)14-6-2-12(3-7-14)17(19,20)21/h2-9H,1,10-11H2.
What are the key properties of 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one?
1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one has a molecular weight of 402.37 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinan-2-one is sourced from PubChem (CID 137443825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).