C10H15NO — CID 137444009
4-ethyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine (PubChem CID 137444009) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-ethyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine.
| Compound Name | 4-ethyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 137444009 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-ethyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine |
| SMILES | CCN1CCOC2C=CC=CC21 |
| InChI | InChI=1S/C10H15NO/c1-2-11-7-8-12-10-6-4-3-5-9(10)11/h3-6,9-10H,2,7-8H2,1H3 |
| InChIKey | OZLYJYKSAYSYDQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |