C12H22F3N3O — CID 137444319
(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(2,2,2-trifluoroethylamino)methanol (PubChem CID 137444319) has the molecular formula C12H22F3N3O and a molecular weight of 281.32 g/mol. Its IUPAC name is (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(2,2,2-trifluoroethylamino)methanol.
| Compound Name | (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(2,2,2-trifluoroethylamino)methanol |
|---|---|
| PubChem CID | 137444319 |
| Molecular Formula | C12H22F3N3O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(2,2,2-trifluoroethylamino)methanol |
| SMILES | CC(C)N1CC2CCC(C1)N2C(O)NCC(F)(F)F |
| InChI | InChI=1S/C12H22F3N3O/c1-8(2)17-5-9-3-4-10(6-17)18(9)11(19)16-7-12(13,14)15/h8-11,16,19H,3-7H2,1-2H3 |
| InChIKey | XLTLWRGPADETRB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|