About N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide
N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide (PubChem CID 137444610) has the molecular formula C21H38N2O2S
and a molecular weight of 382.61 g/mol. Its IUPAC name is N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide |
| PubChem CID | 137444610 |
| Molecular Formula | C21H38N2O2S |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide |
| SMILES | CCN(CCCC(C)(C)c1ccc(NS(C)(=O)=O)cc1)CCC(C)(C)C |
| InChI | InChI=1S/C21H38N2O2S/c1-8-23(17-15-20(2,3)4)16-9-14-21(5,6)18-10-12-19(13-11-18)22-26(7,24)25/h10-13,22H,8-9,14-17H2,1-7H3 |
| InChIKey | BUZUDTFCQNZGOZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide?
The IUPAC name of N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide (CID 137444610) is N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide?
The canonical SMILES for N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide is CCN(CCCC(C)(C)c1ccc(NS(C)(=O)=O)cc1)CCC(C)(C)C.
What is the InChIKey of N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide?
The InChIKey is BUZUDTFCQNZGOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N2O2S/c1-8-23(17-15-20(2,3)4)16-9-14-21(5,6)18-10-12-19(13-11-18)22-26(7,24)25/h10-13,22H,8-9,14-17H2,1-7H3.
What are the key properties of N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide?
N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide has a molecular weight of 382.61 g/mol, XLogP of 4.87, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[5-[3,3-dimethylbutyl(ethyl)amino]-2-methylpentan-2-yl]phenyl]methanesulfonamide is sourced from PubChem (CID 137444610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).