C15H19NO2S — CID 137444689
(2E,3Z,5Z)-1-(benzenesulfonyl)-2-ethylidenehepta-3,5-dien-1-amine (PubChem CID 137444689) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is (2E,3Z,5Z)-1-(benzenesulfonyl)-2-ethylidenehepta-3,5-dien-1-amine.
| Compound Name | (2E,3Z,5Z)-1-(benzenesulfonyl)-2-ethylidenehepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 137444689 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2E,3Z,5Z)-1-(benzenesulfonyl)-2-ethylidenehepta-3,5-dien-1-amine |
| SMILES | C/C=C\C=C/C(=C\C)C(N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO2S/c1-3-5-7-10-13(4-2)15(16)19(17,18)14-11-8-6-9-12-14/h3-12,15H,16H2,1-2H3/b5-3-,10-7-,13-4+ |
| InChIKey | KNLCAJDFSYLMSU-JSQXYQFQSA-N |
| XLogP | 2.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|