About N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine
N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine (PubChem CID 137446280) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine.
Molecular Properties
| Compound Name | N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine |
| PubChem CID | 137446280 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine |
| SMILES | C/N=C/C1=C(C)CC=CC(CC(C)C)=C1 |
| InChI | InChI=1S/C14H21N/c1-11(2)8-13-7-5-6-12(3)14(9-13)10-15-4/h5,7,9-11H,6,8H2,1-4H3/b15-10+ |
| InChIKey | LMHLZYVNJCDSNC-XNTDXEJSSA-N |
| XLogP | 3.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine?
The IUPAC name of N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine (CID 137446280) is N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine.
What is the SMILES notation for N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine?
The canonical SMILES for N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine is C/N=C/C1=C(C)CC=CC(CC(C)C)=C1.
What is the InChIKey of N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine?
The InChIKey is LMHLZYVNJCDSNC-XNTDXEJSSA-N. The full InChI is InChI=1S/C14H21N/c1-11(2)8-13-7-5-6-12(3)14(9-13)10-15-4/h5,7,9-11H,6,8H2,1-4H3/b15-10+.
What are the key properties of N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine?
N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine has a molecular weight of 203.33 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[2-methyl-6-(2-methylpropyl)cyclohepta-1,4,6-trien-1-yl]methanimine is sourced from PubChem (CID 137446280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).