C22H23FN6O — CID 137446356
5-(4,6-dimethyl-3-pyridinyl)-2-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-3-methyl-N-(methylideneamino)pyrimidin-4-amine (PubChem CID 137446356) has the molecular formula C22H23FN6O and a molecular weight of 406.47 g/mol. Its IUPAC name is 5-(4,6-dimethyl-3-pyridinyl)-2-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-3-methyl-N-(methylideneamino)pyrimidin-4-amine.
| Compound Name | 5-(4,6-dimethyl-3-pyridinyl)-2-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-3-methyl-N-(methylideneamino)pyrimidin-4-amine |
|---|---|
| PubChem CID | 137446356 |
| Molecular Formula | C22H23FN6O |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 5-(4,6-dimethyl-3-pyridinyl)-2-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-3-methyl-N-(methylideneamino)pyrimidin-4-amine |
| SMILES | C=NNc1c(-c2cnc(C)cc2C)cn/c(=N\Cc2c(F)ccc3c2CCO3)n1C |
| InChI | InChI=1S/C22H23FN6O/c1-13-9-14(2)25-10-16(13)18-12-27-22(29(4)21(18)28-24-3)26-11-17-15-7-8-30-20(15)6-5-19(17)23/h5-6,9-10,12,28H,3,7-8,11H2,1-2,4H3/b26-22+ |
| InChIKey | NYCNCAJYMSULAQ-XTCLZLMSSA-N |
| XLogP | 3.30 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|