C7H12O4 — CID 137446456
[(3aR,6S,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxymethanol (PubChem CID 137446456) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is [(3aR,6S,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxymethanol.
| Compound Name | [(3aR,6S,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxymethanol |
|---|---|
| PubChem CID | 137446456 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | [(3aR,6S,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxymethanol |
| SMILES | OCO[C@H]1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C7H12O4/c8-4-11-6-3-10-5-1-2-9-7(5)6/h5-8H,1-4H2/t5-,6+,7+/m1/s1 |
| InChIKey | JURHGJPFGNFKHN-VQVTYTSYSA-N |
| XLogP | -0.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|