C9H17NO2 — CID 137446462
(3R,7R,7aR)-3,7a-dimethyl-2,3,3a,5,6,7-hexahydrofuro[3,2-b]pyran-7-amine (PubChem CID 137446462) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (3R,7R,7aR)-3,7a-dimethyl-2,3,3a,5,6,7-hexahydrofuro[3,2-b]pyran-7-amine.
| Compound Name | (3R,7R,7aR)-3,7a-dimethyl-2,3,3a,5,6,7-hexahydrofuro[3,2-b]pyran-7-amine |
|---|---|
| PubChem CID | 137446462 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (3R,7R,7aR)-3,7a-dimethyl-2,3,3a,5,6,7-hexahydrofuro[3,2-b]pyran-7-amine |
| SMILES | C[C@@H]1CO[C@@]2(C)C1OCC[C@H]2N |
| InChI | InChI=1S/C9H17NO2/c1-6-5-12-9(2)7(10)3-4-11-8(6)9/h6-8H,3-5,10H2,1-2H3/t6-,7-,8?,9-/m1/s1 |
| InChIKey | XBNKCVGZXOTMBH-AIPQFCGWSA-N |
| XLogP | 0.53 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |