About methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate
methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate (PubChem CID 137446470) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate.
Molecular Properties
| Compound Name | methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate |
| PubChem CID | 137446470 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate |
| SMILES | C=C(/C=C/N=C/OC)c1nccn1C |
| InChI | InChI=1S/C10H13N3O/c1-9(4-5-11-8-14-3)10-12-6-7-13(10)2/h4-8H,1H2,2-3H3/b5-4+,11-8+ |
| InChIKey | RFNIQYOAHUECJP-OCJIRGAFSA-N |
| XLogP | 1.62 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate?
The IUPAC name of methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate (CID 137446470) is methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate.
What is the SMILES notation for methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate?
The canonical SMILES for methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate is C=C(/C=C/N=C/OC)c1nccn1C.
What is the InChIKey of methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate?
The InChIKey is RFNIQYOAHUECJP-OCJIRGAFSA-N. The full InChI is InChI=1S/C10H13N3O/c1-9(4-5-11-8-14-3)10-12-6-7-13(10)2/h4-8H,1H2,2-3H3/b5-4+,11-8+.
What are the key properties of methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate?
methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate has a molecular weight of 191.23 g/mol, XLogP of 1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(1E)-3-(1-methylimidazol-2-yl)buta-1,3-dienyl]methanimidate is sourced from PubChem (CID 137446470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).