C34H18F8O13S4 — CID 137446498
4-[4-[4-[(3,6-disulfonaphthalen-1-yl)methyl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-5-methylnaphthalene-2,7-disulfonic acid (PubChem CID 137446498) has the molecular formula C34H18F8O13S4 and a molecular weight of 914.76 g/mol. Its IUPAC name is 4-[4-[4-[(3,6-disulfonaphthalen-1-yl)methyl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-5-methylnaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[4-[4-[(3,6-disulfonaphthalen-1-yl)methyl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-5-methylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 137446498 |
| Molecular Formula | C34H18F8O13S4 |
| Molecular Weight | 914.76 g/mol |
| Exact Mass | 913.95 |
| IUPAC Name | 4-[4-[4-[(3,6-disulfonaphthalen-1-yl)methyl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-5-methylnaphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(Oc3c(F)c(F)c(-c4c(F)c(F)c(Cc5cc(S(=O)(=O)O)cc6cc(S(=O)(=O)O)ccc56)c(F)c4F)c(F)c3F)c12 |
| InChI | InChI=1S/C34H18F8O13S4/c1-12-4-17(57(46,47)48)8-15-9-19(59(52,53)54)11-22(23(12)15)55-34-32(41)30(39)25(31(40)33(34)42)24-28(37)26(35)21(27(36)29(24)38)10-14-7-18(58(49,50)51)6-13-5-16(56(43,44)45)2-3-20(13)14/h2-9,11H,10H2,1H3,(H,43,44,45)(H,46,47,48)(H,49,50,51)(H,52,53,54) |
| InChIKey | WIBVVFRXEFGKIY-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 226.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.76 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|